* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1558 |
English Synonyms: | ABBYPHARMA AP-10-1558 |
MDL Number.: | MFCD16988132 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CCOC(=O)c1cc(nc(n1)CNC(=O)OC(C)(C)C)O |
InChi: | InChI=1S/C13H19N3O5/c1-5-20-11(18)8-6-10(17)16-9(15-8)7-14-12(19)21-13(2,3)4/h6H,5,7H2,1-4H3,(H,14,19)(H,15,16,17) |
InChiKey: | InChIKey=WMOUFQBXZDEHHO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.