* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-5780 |
English Synonyms: | ABBYPHARMA AP-10-5780 |
MDL Number.: | MFCD16988527 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccnc(c1)C2(CCCC2)c3ccn[nH]3 |
InChi: | InChI=1S/C13H15N3/c1-4-9-14-11(5-1)13(7-2-3-8-13)12-6-10-15-16-12/h1,4-6,9-10H,2-3,7-8H2,(H,15,16) |
InChiKey: | InChIKey=DFYDGVFQVYUGGM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.