* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-5978 |
English Synonyms: | ABBYPHARMA AP-10-5978 |
MDL Number.: | MFCD16988542 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)NCc1ccccn1.Cl |
InChi: | InChI=1S/C9H12N2O2.ClH/c1-2-13-9(12)11-7-8-5-3-4-6-10-8;/h3-6H,2,7H2,1H3,(H,11,12);1H |
InChiKey: | InChIKey=OBBVHXQVXITUDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.