* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-5554 |
| English Synonyms: | ABBYPHARMA AP-11-5554 |
| MDL Number.: | MFCD16988568 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)(c1ccccn1)N.C(=O)(C(=O)O)O |
| InChi: | InChI=1S/C8H12N2.C2H2O4/c1-8(2,9)7-5-3-4-6-10-7;3-1(4)2(5)6/h3-6H,9H2,1-2H3;(H,3,4)(H,5,6) |
| InChiKey: | InChIKey=BLOULQAFMSJZDX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.