* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-12-5469 |
| English Synonyms: | ABBYPHARMA AP-12-5469 |
| MDL Number.: | MFCD16988620 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | COc1cnc(cc1OCC2CC2)C(=O)[O-].[Na+] |
| InChi: | InChI=1S/C11H13NO4.Na/c1-15-10-5-12-8(11(13)14)4-9(10)16-6-7-2-3-7;/h4-5,7H,2-3,6H2,1H3,(H,13,14);/q;+1/p-1 |
| InChiKey: | InChIKey=SIBQDQLMQQXBDF-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.