* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-5774 |
English Synonyms: | ABBYPHARMA AP-12-5774 |
MDL Number.: | MFCD16988633 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CN(C)CCC(c1ccccn1)N.Cl.Cl |
InChi: | InChI=1S/C10H17N3.2ClH/c1-13(2)8-6-9(11)10-5-3-4-7-12-10;;/h3-5,7,9H,6,8,11H2,1-2H3;2*1H |
InChiKey: | InChIKey=CUSCMGACGOBQKG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.