* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-5880 |
English Synonyms: | ABBYPHARMA AP-12-5880 |
MDL Number.: | MFCD16988635 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)C(c2ccccn2)N)Cl.Cl |
InChi: | InChI=1S/C12H11ClN2.ClH/c13-10-6-2-1-5-9(10)12(14)11-7-3-4-8-15-11;/h1-8,12H,14H2;1H |
InChiKey: | InChIKey=PLXOQMQXQGWBEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.