* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-5912 |
English Synonyms: | ABBYPHARMA AP-12-5912 |
MDL Number.: | MFCD16988637 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(=O)Nc1cc(cnc1)C2CCNCC2.Cl |
InChi: | InChI=1S/C12H17N3O.ClH/c1-9(16)15-12-6-11(7-14-8-12)10-2-4-13-5-3-10;/h6-8,10,13H,2-5H2,1H3,(H,15,16);1H |
InChiKey: | InChIKey=GFOPJZOGSUOKNA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.