* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-13-5279 |
English Synonyms: | ABBYPHARMA AP-13-5279 |
MDL Number.: | MFCD16988655 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1cc(ncc1Br)C(=O)OC.Cl |
InChi: | InChI=1S/C8H8BrNO2.ClH/c1-5-3-7(8(11)12-2)10-4-6(5)9;/h3-4H,1-2H3;1H |
InChiKey: | InChIKey=JALCGOJWXDBDFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.