* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-14-5229 |
| English Synonyms: | ALPHACHIRON 25876B802 ; ABBYPHARMA AP-14-5229 |
| MDL Number.: | MFCD16988714 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2)C(C)(C)OCOC |
| InChi: | InChI=1S/C16H26BNO4/c1-14(2,20-11-19-7)13-9-8-12(10-18-13)17-21-15(3,4)16(5,6)22-17/h8-10H,11H2,1-7H3 |
| InChiKey: | InChIKey=HRRWPOHIKZBVCR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.