* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-14-5230 |
| English Synonyms: | ABBYPHARMA AP-14-5230 |
| MDL Number.: | MFCD16988715 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccnc(c1)CN2CCCN(CC2)CCN.Cl.Cl |
| InChi: | InChI=1S/C13H22N4.2ClH/c14-5-9-16-7-3-8-17(11-10-16)12-13-4-1-2-6-15-13;;/h1-2,4,6H,3,5,7-12,14H2;2*1H |
| InChiKey: | InChIKey=UIBQRCBRGVKNFN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.