* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-16-5180 |
English Synonyms: | ABBYPHARMA AP-16-5180 |
MDL Number.: | MFCD16988750 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c[n+](ccc1CN)[O-].Cl |
InChi: | InChI=1S/C6H8N2O.ClH/c7-5-6-1-3-8(9)4-2-6;/h1-4H,5,7H2;1H |
InChiKey: | InChIKey=CFKSKKGMDCPEOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.