* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-17-5092 |
English Synonyms: | ABBYPHARMA AP-17-5092 |
MDL Number.: | MFCD16988773 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(=O)c1ccc(cn1)F.Cl |
InChi: | InChI=1S/C7H6FNO.ClH/c1-5(10)7-3-2-6(8)4-9-7;/h2-4H,1H3;1H |
InChiKey: | InChIKey=GSNPCCWOCZIAOY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.