* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-17-5187 |
English Synonyms: | ABBYPHARMA AP-17-5187 |
MDL Number.: | MFCD16988775 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1cc(c(nc1)F)CN.Cl |
InChi: | InChI=1S/C7H9FN2.ClH/c1-5-2-6(3-9)7(8)10-4-5;/h2,4H,3,9H2,1H3;1H |
InChiKey: | InChIKey=JPOVMGWYTWJWPG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.