* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-17-5300 |
English Synonyms: | ABBYPHARMA AP-17-5300 |
MDL Number.: | MFCD16988776 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(ncc1F)C(=O)O.Cl |
InChi: | InChI=1S/C6H4FNO2.ClH/c7-4-1-2-5(6(9)10)8-3-4;/h1-3H,(H,9,10);1H |
InChiKey: | InChIKey=LMBXHNCCBIMEOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.