* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-10-7904 |
| English Synonyms: | ABBYPHARMA AP-10-7904 |
| MDL Number.: | MFCD16989256 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC1=C(CCl)N=C(O1)C(N)=O |
| InChi: | InChI=1S/C6H7ClN2O2/c1-3-4(2-7)9-6(11-3)5(8)10/h2H2,1H3,(H2,8,10) |
| InChiKey: | InChIKey=GPNLVMBVGFTGBG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.