* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7018 |
English Synonyms: | ABBYPHARMA AP-11-7018 |
MDL Number.: | MFCD16989357 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC1=NC(CO)=CO1 |
InChi: | InChI=1S/C6H9NO3/c1-2-9-6-7-5(3-8)4-10-6/h4,8H,2-3H2,1H3 |
InChiKey: | InChIKey=IWLLWALLEPECEK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.