* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7035 |
English Synonyms: | ABBYPHARMA AP-11-7035 |
MDL Number.: | MFCD16989374 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | OCC1=NC(Cl)=CO1 |
InChi: | InChI=1S/C4H4ClNO2/c5-3-2-8-4(1-7)6-3/h2,7H,1H2 |
InChiKey: | InChIKey=DJLQNDMZVZLYGN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.