* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7051 |
English Synonyms: | ABBYPHARMA AP-11-7051 |
MDL Number.: | MFCD16989390 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | NC(=O)C1=NC(=CO1)C(N)=O |
InChi: | InChI=1S/C5H5N3O3/c6-3(9)2-1-11-5(8-2)4(7)10/h1H,(H2,6,9)(H2,7,10) |
InChiKey: | InChIKey=UNEQFVVZNSHYBR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.