* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,4-DIBROMOOXAZOLE |
| CAS: | 1240598-59-7 |
| English Synonyms: | 2,4-DIBROMOOXAZOLE |
| MDL Number.: | MFCD16989417 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1c(nc(o1)Br)Br |
| InChi: | InChI=1S/C3HBr2NO/c4-2-1-7-3(5)6-2/h1H |
| InChiKey: | InChIKey=HHJMCPWKOXDTLL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.