* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7178 |
English Synonyms: | ABBYPHARMA AP-11-7178 |
MDL Number.: | MFCD16989505 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | OCC1=C(CO)N=C(O1)C1=CC=CC=C1 |
InChi: | InChI=1S/C11H11NO3/c13-6-9-10(7-14)15-11(12-9)8-4-2-1-3-5-8/h1-5,13-14H,6-7H2 |
InChiKey: | InChIKey=PZXBGQCMOGTKJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.