* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7681 |
English Synonyms: | ABBYPHARMA AP-11-7681 |
MDL Number.: | MFCD16990001 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1=NC(C)=C(O)O1 |
InChi: | InChI=1S/C5H7NO2/c1-3-5(7)8-4(2)6-3/h7H,1-2H3 |
InChiKey: | InChIKey=VXKUNKKJLJKPAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.