* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHOXY-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE |
English Synonyms: | 9-METHOXY-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE |
MDL Number.: | MFCD16991112 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COc1cccc2c1OCCNC2 |
InChi: | InChI=1S/C10H13NO2/c1-12-9-4-2-3-8-7-11-5-6-13-10(8)9/h2-4,11H,5-7H2,1H3 |
InChiKey: | InChIKey=MMGSSGIIFHIFJD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.