* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 9-FLUORO-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE |
English Synonyms: | 9-FLUORO-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE |
MDL Number.: | MFCD16991114 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc2c(c(c1)F)OCCNC2 |
InChi: | InChI=1S/C9H10FNO/c10-8-3-1-2-7-6-11-4-5-12-9(7)8/h1-3,11H,4-6H2 |
InChiKey: | InChIKey=YLZOLFBJUDFHNH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.