* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)QUINAZOLIN-4-OL |
CAS: | 1009303-58-5 |
English Synonyms: | 6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)QUINAZOLIN-4-OL |
MDL Number.: | MFCD16995177 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc3c(c2)c(ncn3)O |
InChi: | InChI=1S/C14H17BN2O3/c1-13(2)14(3,4)20-15(19-13)9-5-6-11-10(7-9)12(18)17-8-16-11/h5-8H,1-4H3,(H,16,17,18) |
InChiKey: | InChIKey=CFNLSARGOZGEQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.