* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)IMIDAZO[1,2-A]PYRAZINE |
| English Synonyms: | 8-CHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)IMIDAZO[1,2-A]PYRAZINE |
| MDL Number.: | MFCD16995960 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cnc3n2ccnc3Cl |
| InChi: | InChI=1S/C12H15BClN3O2/c1-11(2)12(3,4)19-13(18-11)8-7-16-10-9(14)15-5-6-17(8)10/h5-7H,1-4H3 |
| InChiKey: | InChIKey=ISYWMVAXEKUSBH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.