* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4,4,5,5-TETRAMETHYL-2-(3-METHYLBUT-1-ENYL)-1,3,2-DIOXABOROLANE |
CAS: | 177949-92-7 |
English Synonyms: | 4,4,5,5-TETRAMETHYL-2-[(1E)-3-METHYLBUT-1-EN-1-YL]-1,3,2-DIOXABOROLANE ; 4,4,5,5-TETRAMETHYL-2-(3-METHYLBUT-1-ENYL)-1,3,2-DIOXABOROLANE |
MDL Number.: | MFCD16996225 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)/C=C/C(C)C |
InChi: | InChI=1S/C11H21BO2/c1-9(2)7-8-12-13-10(3,4)11(5,6)14-12/h7-9H,1-6H3/b8-7+ |
InChiKey: | InChIKey=MOLDCQXBYNONGT-BQYQJAHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.