* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-ETHYL-4-METHYLPHENOL |
CAS: | 3855-26-3 |
English Synonyms: | 2-ETHYL-4-METHYLPHENOL |
MDL Number.: | MFCD16997590 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCc1cc(ccc1O)C |
InChi: | InChI=1S/C9H12O/c1-3-8-6-7(2)4-5-9(8)10/h4-6,10H,3H2,1-2H3 |
InChiKey: | InChIKey=AVVVXUXMKWPKAJ-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.