* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(2-PHENYLETHYL)-4-PIPERIDINONE |
| CAS: | 126937-87-9 |
| English Synonyms: | 2-(2-PHENYLETHYL)-4-PIPERIDINONE |
| MDL Number.: | MFCD17013154 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)CCC2CC(=O)CCN2 |
| InChi: | InChI=1S/C13H17NO/c15-13-8-9-14-12(10-13)7-6-11-4-2-1-3-5-11/h1-5,12,14H,6-10H2 |
| InChiKey: | InChIKey=FTJIYQQBHMQPJC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.