* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105213-001 |
English Synonyms: | WUXIAPPTEC WX105213-005 ; WUXIAPPTEC WX105213-010 ; WUXIAPPTEC WX105213-001 |
MDL Number.: | MFCD17016341 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | O=C(OCC1=CC=CC=C1)N1CCC2(CC1)OCC1=C2N=CN1 |
InChi: | InChI=1S/C17H19N3O3/c21-16(22-10-13-4-2-1-3-5-13)20-8-6-17(7-9-20)15-14(11-23-17)18-12-19-15/h1-5,12H,6-11H2,(H,18,19) |
InChiKey: | InChIKey=ZUICIGSAZFTDBO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.