* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105218-001 |
English Synonyms: | WUXIAPPTEC WX105218-001 ; WUXIAPPTEC WX105218-010 ; WUXIAPPTEC WX105218-005 |
MDL Number.: | MFCD17016343 |
H bond acceptor: | 8 |
H bond donor: | 0 |
Smile: | CSC1=NC2=C(CN(CC22CCN(CC2)C(=O)OCC2=CC=CC=C2)C(=O)OC(C)(C)C)C=N1 |
InChi: | InChI=1S/C25H32N4O4S/c1-24(2,3)33-23(31)29-15-19-14-26-21(34-4)27-20(19)25(17-29)10-12-28(13-11-25)22(30)32-16-18-8-6-5-7-9-18/h5-9,14H,10-13,15-17H2,1-4H3 |
InChiKey: | InChIKey=GSJXTRRUPXWJMT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.