* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105262-001 |
English Synonyms: | WUXIAPPTEC WX105262-005 ; WUXIAPPTEC WX105262-001 ; WUXIAPPTEC WX105262-010 |
MDL Number.: | MFCD17016368 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CCC2(C1)CN1C(C2)=NC2=C(CNC2)C1=O |
InChi: | InChI=1S/C17H24N4O3/c1-16(2,3)24-15(23)20-5-4-17(9-20)6-13-19-12-8-18-7-11(12)14(22)21(13)10-17/h18H,4-10H2,1-3H3 |
InChiKey: | InChIKey=IBQWXTASKXQWHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.