* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105264-001 |
English Synonyms: | WUXIAPPTEC WX105264-005 ; WUXIAPPTEC WX105264-001 ; WUXIAPPTEC WX105264-010 |
MDL Number.: | MFCD17016370 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CCC2(C1)CN1C(C2)=NN=C1C(O)=O |
InChi: | InChI=1S/C14H20N4O4/c1-13(2,3)22-12(21)17-5-4-14(7-17)6-9-15-16-10(11(19)20)18(9)8-14/h4-8H2,1-3H3,(H,19,20) |
InChiKey: | InChIKey=FWPPAZUUYICZDQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.