* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105315-001 |
| English Synonyms: | WUXIAPPTEC WX105315-005 ; WUXIAPPTEC WX105315-001 ; WUXIAPPTEC WX105315-010 |
| MDL Number.: | MFCD17016405 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2(CC1)COC1=NC=CC=C1S(=O)(=O)N2 |
| InChi: | InChI=1S/C16H23N3O5S/c1-15(2,3)24-14(20)19-9-6-16(7-10-19)11-23-13-12(5-4-8-17-13)25(21,22)18-16/h4-5,8,18H,6-7,9-11H2,1-3H3 |
| InChiKey: | InChIKey=INFOIYCGJYCEFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.