* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115096-001 |
| English Synonyms: | WUXIAPPTEC WX115096-005 ; WUXIAPPTEC WX115096-001 ; WUXIAPPTEC WX115096-010 |
| MDL Number.: | MFCD17016582 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC[C@@H]2OCC3=CN=C(N3C2CC1)C(O)=O |
| InChi: | InChI=1S/C16H23N3O5/c1-16(2,3)24-15(22)18-6-4-11-12(5-7-18)23-9-10-8-17-13(14(20)21)19(10)11/h8,11-12H,4-7,9H2,1-3H3,(H,20,21)/t11?,12-/m0/s1 |
| InChiKey: | InChIKey=WOQNTRSNWFBACZ-KIYNQFGBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.