* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115098-001 |
| English Synonyms: | WUXIAPPTEC WX115098-001 ; WUXIAPPTEC WX115098-010 ; WUXIAPPTEC WX115098-005 |
| MDL Number.: | MFCD17016584 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC[C@@H]2OCC3=C(C=NN3C2CC1)C(O)=O |
| InChi: | InChI=1S/C16H23N3O5/c1-16(2,3)24-15(22)18-6-4-11-13(5-7-18)23-9-12-10(14(20)21)8-17-19(11)12/h8,11,13H,4-7,9H2,1-3H3,(H,20,21)/t11?,13-/m0/s1 |
| InChiKey: | InChIKey=TZXFLQAVZYAPPG-YUZLPWPTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.