* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX145094-001 |
English Synonyms: | WUXIAPPTEC WX145094-005 ; WUXIAPPTEC WX145094-001 ; WUXIAPPTEC WX145094-010 |
MDL Number.: | MFCD17016981 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1=CC=C2CC3=CC=C(N)N3CCN12 |
InChi: | InChI=1S/C14H17N3O2/c1-2-19-14(18)12-5-3-10-9-11-4-6-13(15)17(11)8-7-16(10)12/h3-6H,2,7-9,15H2,1H3 |
InChiKey: | InChIKey=CSLSQMPIQPRQPU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.