* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115206-001 |
| English Synonyms: | WUXIAPPTEC WX115206-001 ; WUXIAPPTEC WX115206-005 ; WUXIAPPTEC WX115206-010 |
| MDL Number.: | MFCD17017254 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CSC1=NC2=C(CN([C@@H]3CN(C[C@H]23)C(=O)OC(C)(C)C)C(=O)OCC2=CC=CC=C2)C=N1 |
| InChi: | InChI=1S/C23H28N4O4S/c1-23(2,3)31-21(28)26-12-17-18(13-26)27(11-16-10-24-20(32-4)25-19(16)17)22(29)30-14-15-8-6-5-7-9-15/h5-10,17-18H,11-14H2,1-4H3/t17-,18+/m0/s1 |
| InChiKey: | InChIKey=CRPCDCAEUYLSEA-ZWKOTPCHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.