* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115213-001 |
| English Synonyms: | WUXIAPPTEC WX115213-010 ; WUXIAPPTEC WX115213-001 ; WUXIAPPTEC WX115213-005 |
| MDL Number.: | MFCD17017261 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CSC1=NC2=C(COC3CCN(CC23)C(=O)OC(C)(C)C)C=N1 |
| InChi: | InChI=1S/C16H23N3O3S/c1-16(2,3)22-15(20)19-6-5-12-11(8-19)13-10(9-21-12)7-17-14(18-13)23-4/h7,11-12H,5-6,8-9H2,1-4H3 |
| InChiKey: | InChIKey=PSDFUQVMPROXAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.