* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125086-001 |
| English Synonyms: | WUXIAPPTEC WX125086-001 ; WUXIAPPTEC WX125086-005 ; WUXIAPPTEC WX125086-010 |
| MDL Number.: | MFCD17017268 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1C2CCC1(CC2)C1=CNN=C1N |
| InChi: | InChI=1S/C14H22N4O2/c1-13(2,3)20-12(19)18-9-4-6-14(18,7-5-9)10-8-16-17-11(10)15/h8-9H,4-7H2,1-3H3,(H3,15,16,17) |
| InChiKey: | InChIKey=IZZRXUJNRSUXMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.