* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX140128-001 |
| English Synonyms: | WUXIAPPTEC WX140128-010 ; WUXIAPPTEC WX140128-005 ; WUXIAPPTEC WX140128-001 |
| MDL Number.: | MFCD17017277 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C1CCNC2=NC(SC)=NC=C12 |
| InChi: | InChI=1S/C11H15N3O2S/c1-3-16-10(15)7-4-5-12-9-8(7)6-13-11(14-9)17-2/h6-7H,3-5H2,1-2H3,(H,12,13,14) |
| InChiKey: | InChIKey=KMAUCVMZNJMAOR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.