* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PHENYL-2-AZA-TRICYCLO[4.4.0.02,8]DEC-9-EN-6-YLAMINE |
| English Synonyms: | 7-PHENYL-2-AZA-TRICYCLO[4.4.0.02,8]DEC-9-EN-6-YLAMINE |
| MDL Number.: | MFCD17017531 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C1(=CC=CC=C1)C1C2(CCCN3C2C=CC13)N |
| InChi: | InChI=1S/C15H18N2/c16-15-9-4-10-17-12(7-8-13(15)17)14(15)11-5-2-1-3-6-11/h1-3,5-8,12-14H,4,9-10,16H2 |
| InChiKey: | InChIKey=ULYPTIPLANRUEQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.