* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115345-001 |
English Synonyms: | WUXIAPPTEC WX115345-001 ; WUXIAPPTEC WX115345-010 ; WUXIAPPTEC WX115345-005 |
MDL Number.: | MFCD17017624 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | [H][C@]12CN(C[C@@]1([H])C1=C(CO2)C=NN1)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C13H19N3O3/c1-13(2,3)19-12(17)16-5-9-10(6-16)18-7-8-4-14-15-11(8)9/h4,9-10H,5-7H2,1-3H3,(H,14,15)/t9-,10+/m1/s1 |
InChiKey: | InChIKey=CAZPPGOVZHQMHN-ZJUUUORDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.