* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115346-001 |
English Synonyms: | WUXIAPPTEC WX115346-010 ; WUXIAPPTEC WX115346-005 ; WUXIAPPTEC WX115346-001 |
MDL Number.: | MFCD17017625 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | [H][C@]12CN(C[C@@]1([H])C1=C(CO2)SC(N)=N1)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C13H19N3O3S/c1-13(2,3)19-12(17)16-4-7-8(5-16)18-6-9-10(7)15-11(14)20-9/h7-8H,4-6H2,1-3H3,(H2,14,15)/t7-,8+/m1/s1 |
InChiKey: | InChIKey=MSDSPJBCZYHVQY-SFYZADRCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.