* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BICYCLO[3.2.1]OCTAN-6-ONE, 8-PHENYL-, (1R,5R,8S)-REL- |
| CAS: | 848356-22-9 |
| English Synonyms: | BICYCLO[3.2.1]OCTAN-6-ONE, 8-PHENYL-, (1R,5R,8S)-REL- |
| MDL Number.: | MFCD17017924 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | [H][C@]12CC(=O)[C@]([H])(CCC1)[C@H]2C1=CC=CC=C1 |
| InChi: | InChI=1S/C14H16O/c15-13-9-11-7-4-8-12(13)14(11)10-5-2-1-3-6-10/h1-3,5-6,11-12,14H,4,7-9H2/t11-,12+,14+/m1/s1 |
| InChiKey: | InChIKey=KEENQVWKNHQIPW-DYEKYZERSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.