* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-5-PHENYL-2,3-DIHYDRO-1,3-BENZOXAZOL-2-ONE |
| English Synonyms: | 7-CHLORO-5-PHENYL-2,3-DIHYDRO-1,3-BENZOXAZOL-2-ONE |
| MDL Number.: | MFCD17061434 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2cc3c(c(c2)Cl)oc(=O)[nH]3 |
| InChi: | InChI=1S/C13H8ClNO2/c14-10-6-9(8-4-2-1-3-5-8)7-11-12(10)17-13(16)15-11/h1-7H,(H,15,16) |
| InChiKey: | InChIKey=FPSGHZLUKIGCKK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.