* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10723545 |
English Synonyms: | SELENA SEL10723545 |
MDL Number.: | MFCD17118278 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCCCCCn1cc(cn1)C(CC)O |
InChi: | InChI=1S/C14H26N2O/c1-3-5-6-7-8-9-10-16-12-13(11-15-16)14(17)4-2/h11-12,14,17H,3-10H2,1-2H3 |
InChiKey: | InChIKey=OTTIRTCZUIKUOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.