* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10723827 |
English Synonyms: | SELENA SEL10723827 |
MDL Number.: | MFCD17118557 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCNCc1nnnn1c2ccc(cc2)CC |
InChi: | InChI=1S/C13H19N5/c1-3-9-14-10-13-15-16-17-18(13)12-7-5-11(4-2)6-8-12/h5-8,14H,3-4,9-10H2,1-2H3 |
InChiKey: | InChIKey=HGOLLXBCHAKXOI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.