* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VATALANIB HCL |
| CAS: | 212141-54-3 |
| English Synonyms: | VATALANIB HCL ; VATALANIB |
| MDL Number.: | MFCD17170385 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)c(nnc2Nc3ccc(cc3)Cl)Cc4ccncc4.Cl |
| InChi: | InChI=1S/C20H15ClN4.ClH/c21-15-5-7-16(8-6-15)23-20-18-4-2-1-3-17(18)19(24-25-20)13-14-9-11-22-12-10-14;/h1-12H,13H2,(H,23,25);1H |
| InChiKey: | InChIKey=BDKWVFXIGVUEGA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.