* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 24019 |
| English Synonyms: | KINGSHCHEM 24019 |
| MDL Number.: | MFCD17181128 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCOc1cccc-2c1Cc3c2nc(s3)N |
| InChi: | InChI=1S/C12H12N2OS/c1-2-15-9-5-3-4-7-8(9)6-10-11(7)14-12(13)16-10/h3-5H,2,6H2,1H3,(H2,13,14) |
| InChiKey: | InChIKey=CSOFXGZPJBHLHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.